C19H18ClN3O3S — CID 9328320
N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-3-cyanobenzamide (PubChem CID 9328320) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-3-cyanobenzamide.
| Compound Name | N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-3-cyanobenzamide |
|---|---|
| PubChem CID | 9328320 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-3-cyanobenzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C19H18ClN3O3S/c20-17-8-7-16(22-19(24)15-6-4-5-14(11-15)13-21)12-18(17)27(25,26)23-9-2-1-3-10-23/h4-8,11-12H,1-3,9-10H2,(H,22,24) |
| InChIKey | WXIMAODNYWAGRU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |