C20H22ClN3O4S — CID 2583012
N-(4-acetamidophenyl)-4-chloro-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 2583012) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-4-chloro-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(4-acetamidophenyl)-4-chloro-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2583012 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N-(4-acetamidophenyl)-4-chloro-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-14(25)22-16-6-8-17(9-7-16)23-20(26)15-5-10-18(21)19(13-15)29(27,28)24-11-3-2-4-12-24/h5-10,13H,2-4,11-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | YBKJENJHMFSCDV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |