C20H21FN2O4S — CID 26665148
N-(4-acetylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 26665148) has the molecular formula C20H21FN2O4S and a molecular weight of 404.46 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(4-acetylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26665148 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-(4-acetylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H21FN2O4S/c1-14(24)15-5-8-17(9-6-15)22-20(25)16-7-10-18(21)19(13-16)28(26,27)23-11-3-2-4-12-23/h5-10,13H,2-4,11-12H2,1H3,(H,22,25) |
| InChIKey | ULZYTUPTSSEMHG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |