C20H19FN2O3S — CID 43042263
N-(3-ethynylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 43042263) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3-ethynylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43042263 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-(3-ethynylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | C#Cc1cccc(NC(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C20H19FN2O3S/c1-2-15-7-6-8-17(13-15)22-20(24)16-9-10-18(21)19(14-16)27(25,26)23-11-4-3-5-12-23/h1,6-10,13-14H,3-5,11-12H2,(H,22,24) |
| InChIKey | ZZNBUHONQZOAFM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|