C18H18BrFN2O3S — CID 1101775
4-bromo-N-(3-fluorophenyl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 1101775) has the molecular formula C18H18BrFN2O3S and a molecular weight of 441.32 g/mol. Its IUPAC name is 4-bromo-N-(3-fluorophenyl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-bromo-N-(3-fluorophenyl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 1101775 |
| Molecular Formula | C18H18BrFN2O3S |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 4-bromo-N-(3-fluorophenyl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1ccc(Br)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C18H18BrFN2O3S/c19-16-8-7-13(18(23)21-15-6-4-5-14(20)12-15)11-17(16)26(24,25)22-9-2-1-3-10-22/h4-8,11-12H,1-3,9-10H2,(H,21,23) |
| InChIKey | ISAOBGORZMSZEL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |