C25H22FN3O4S — CID 39500774
N-[3-[(3-cyanophenyl)methoxy]phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 39500774) has the molecular formula C25H22FN3O4S and a molecular weight of 479.53 g/mol. Its IUPAC name is N-[3-[(3-cyanophenyl)methoxy]phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 39500774 |
| Molecular Formula | C25H22FN3O4S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[3-[(3-cyanophenyl)methoxy]phenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | N#Cc1cccc(COc2cccc(NC(=O)c3ccc(F)c(S(=O)(=O)N4CCCC4)c3)c2)c1 |
| InChI | InChI=1S/C25H22FN3O4S/c26-23-10-9-20(14-24(23)34(31,32)29-11-1-2-12-29)25(30)28-21-7-4-8-22(15-21)33-17-19-6-3-5-18(13-19)16-27/h3-10,13-15H,1-2,11-12,17H2,(H,28,30) |
| InChIKey | FTORVYILRUCULA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |