C18H16ClN3O4S — CID 4849756
4-chloro-N-(3-cyanophenyl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 4849756) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is 4-chloro-N-(3-cyanophenyl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(3-cyanophenyl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4849756 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-chloro-N-(3-cyanophenyl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C18H16ClN3O4S/c19-16-5-4-14(18(23)21-15-3-1-2-13(10-15)12-20)11-17(16)27(24,25)22-6-8-26-9-7-22/h1-5,10-11H,6-9H2,(H,21,23) |
| InChIKey | OIHJVEMFAPRQAA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |