C19H22ClN3O6S2 — CID 26590050
4-chloro-3-(dimethylsulfamoyl)-N-(3-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 26590050) has the molecular formula C19H22ClN3O6S2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 4-chloro-3-(dimethylsulfamoyl)-N-(3-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 4-chloro-3-(dimethylsulfamoyl)-N-(3-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 26590050 |
| Molecular Formula | C19H22ClN3O6S2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 4-chloro-3-(dimethylsulfamoyl)-N-(3-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)ccc1Cl |
| InChI | InChI=1S/C19H22ClN3O6S2/c1-22(2)31(27,28)18-12-14(6-7-17(18)20)19(24)21-15-4-3-5-16(13-15)30(25,26)23-8-10-29-11-9-23/h3-7,12-13H,8-11H2,1-2H3,(H,21,24) |
| InChIKey | RHMGAPSIDVFCSE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |