C16H17ClN2O3S — CID 26537805
4-chloro-3-(dimethylsulfamoyl)-N-(3-methylphenyl)benzamide (PubChem CID 26537805) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 4-chloro-3-(dimethylsulfamoyl)-N-(3-methylphenyl)benzamide.
| Compound Name | 4-chloro-3-(dimethylsulfamoyl)-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 26537805 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 4-chloro-3-(dimethylsulfamoyl)-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-11-5-4-6-13(9-11)18-16(20)12-7-8-14(17)15(10-12)23(21,22)19(2)3/h4-10H,1-3H3,(H,18,20) |
| InChIKey | CFMIPEFKBGXCAV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |