C20H24ClN3O5S2 — CID 26251939
4-chloro-3-(dimethylsulfamoyl)-N-(3-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 26251939) has the molecular formula C20H24ClN3O5S2 and a molecular weight of 486.02 g/mol. Its IUPAC name is 4-chloro-3-(dimethylsulfamoyl)-N-(3-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 4-chloro-3-(dimethylsulfamoyl)-N-(3-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 26251939 |
| Molecular Formula | C20H24ClN3O5S2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 4-chloro-3-(dimethylsulfamoyl)-N-(3-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)ccc1Cl |
| InChI | InChI=1S/C20H24ClN3O5S2/c1-23(2)31(28,29)19-13-15(9-10-18(19)21)20(25)22-16-7-6-8-17(14-16)30(26,27)24-11-4-3-5-12-24/h6-10,13-14H,3-5,11-12H2,1-2H3,(H,22,25) |
| InChIKey | IXOZTLRJZNVYHS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |