C19H20N2O5S — CID 3242230
3-[(3-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid (PubChem CID 3242230) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 3-[(3-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid.
| Compound Name | 3-[(3-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 3242230 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[(3-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C19H20N2O5S/c22-18(20-16-8-4-7-15(12-16)19(23)24)14-6-5-9-17(13-14)27(25,26)21-10-2-1-3-11-21/h4-9,12-13H,1-3,10-11H2,(H,20,22)(H,23,24) |
| InChIKey | NMLTYVFSQJBYCF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |