C18H17ClN2O5S — CID 1315383
3-[(2-chloro-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoic acid (PubChem CID 1315383) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is 3-[(2-chloro-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoic acid.
| Compound Name | 3-[(2-chloro-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 1315383 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 3-[(2-chloro-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Cl)c1 |
| InChI | InChI=1S/C18H17ClN2O5S/c19-16-7-6-14(27(25,26)21-8-1-2-9-21)11-15(16)17(22)20-13-5-3-4-12(10-13)18(23)24/h3-7,10-11H,1-2,8-9H2,(H,20,22)(H,23,24) |
| InChIKey | ODBFBLZNCCKIBP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |