C18H15Cl2N3O3S — CID 55480384
2-chloro-N-(4-chloro-3-cyanophenyl)-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55480384) has the molecular formula C18H15Cl2N3O3S and a molecular weight of 424.31 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-cyanophenyl)-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(4-chloro-3-cyanophenyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55480384 |
| Molecular Formula | C18H15Cl2N3O3S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-cyanophenyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | N#Cc1cc(NC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Cl)ccc1Cl |
| InChI | InChI=1S/C18H15Cl2N3O3S/c19-16-5-3-13(9-12(16)11-21)22-18(24)15-10-14(4-6-17(15)20)27(25,26)23-7-1-2-8-23/h3-6,9-10H,1-2,7-8H2,(H,22,24) |
| InChIKey | HKOVBMJVRAHPNX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |