C25H24ClN3O4S — CID 1240122
N-(4-benzamidophenyl)-2-chloro-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 1240122) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is N-(4-benzamidophenyl)-2-chloro-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(4-benzamidophenyl)-2-chloro-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 1240122 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | N-(4-benzamidophenyl)-2-chloro-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24ClN3O4S/c26-23-14-13-21(34(32,33)29-15-5-2-6-16-29)17-22(23)25(31)28-20-11-9-19(10-12-20)27-24(30)18-7-3-1-4-8-18/h1,3-4,7-14,17H,2,5-6,15-16H2,(H,27,30)(H,28,31) |
| InChIKey | XZQUVORVEVEOHR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |