C23H27ClN2O4S — CID 46570003
2-chloro-N-(4-cyclopentyloxyphenyl)-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 46570003) has the molecular formula C23H27ClN2O4S and a molecular weight of 463.00 g/mol. Its IUPAC name is 2-chloro-N-(4-cyclopentyloxyphenyl)-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(4-cyclopentyloxyphenyl)-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46570003 |
| Molecular Formula | C23H27ClN2O4S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-chloro-N-(4-cyclopentyloxyphenyl)-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(OC2CCCC2)cc1)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C23H27ClN2O4S/c24-22-13-12-20(31(28,29)26-14-4-1-5-15-26)16-21(22)23(27)25-17-8-10-19(11-9-17)30-18-6-2-3-7-18/h8-13,16,18H,1-7,14-15H2,(H,25,27) |
| InChIKey | PVVRXQFBZJIZTR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |