C22H25ClN2O4S — CID 55563879
2-chloro-N-(3-cyclopentyloxyphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55563879) has the molecular formula C22H25ClN2O4S and a molecular weight of 448.97 g/mol. Its IUPAC name is 2-chloro-N-(3-cyclopentyloxyphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(3-cyclopentyloxyphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55563879 |
| Molecular Formula | C22H25ClN2O4S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-chloro-N-(3-cyclopentyloxyphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cccc(OC2CCCC2)c1)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C22H25ClN2O4S/c23-21-11-10-19(30(27,28)25-12-3-4-13-25)15-20(21)22(26)24-16-6-5-9-18(14-16)29-17-7-1-2-8-17/h5-6,9-11,14-15,17H,1-4,7-8,12-13H2,(H,24,26) |
| InChIKey | CRZXUFWGXYZUKA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |