C17H16Cl2N2O3S — CID 42991910
2,3-dichloro-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 42991910) has the molecular formula C17H16Cl2N2O3S and a molecular weight of 399.30 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2,3-dichloro-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 42991910 |
| Molecular Formula | C17H16Cl2N2O3S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2,3-dichloro-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl2N2O3S/c18-15-8-4-7-14(16(15)19)17(22)20-12-5-3-6-13(11-12)25(23,24)21-9-1-2-10-21/h3-8,11H,1-2,9-10H2,(H,20,22) |
| InChIKey | WACNXOHFPVYICR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |