C17H16Cl2N2O4S — CID 18108806
2,3-dichloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 18108806) has the molecular formula C17H16Cl2N2O4S and a molecular weight of 415.30 g/mol. Its IUPAC name is 2,3-dichloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2,3-dichloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 18108806 |
| Molecular Formula | C17H16Cl2N2O4S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2,3-dichloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCCC2)ccc1O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl2N2O4S/c18-13-5-3-4-12(16(13)19)17(23)20-14-10-11(6-7-15(14)22)26(24,25)21-8-1-2-9-21/h3-7,10,22H,1-2,8-9H2,(H,20,23) |
| InChIKey | XXYLDWHZHQWLAN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|