C21H21N3O5S — CID 55791911
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1-methyl-2-oxoquinoline-4-carboxamide (PubChem CID 55791911) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1-methyl-2-oxoquinoline-4-carboxamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1-methyl-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55791911 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1-methyl-2-oxoquinoline-4-carboxamide |
| SMILES | Cn1c(=O)cc(C(=O)Nc2cc(S(=O)(=O)N3CCCC3)ccc2O)c2ccccc21 |
| InChI | InChI=1S/C21H21N3O5S/c1-23-18-7-3-2-6-15(18)16(13-20(23)26)21(27)22-17-12-14(8-9-19(17)25)30(28,29)24-10-4-5-11-24/h2-3,6-9,12-13,25H,4-5,10-11H2,1H3,(H,22,27) |
| InChIKey | UUUJCXBWRHASGR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|