C13H18N2O4S — CID 51186069
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 51186069) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 51186069 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CCC(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C13H18N2O4S/c1-2-13(17)14-11-9-10(5-6-12(11)16)20(18,19)15-7-3-4-8-15/h5-6,9,16H,2-4,7-8H2,1H3,(H,14,17) |
| InChIKey | DAFUPSJRFOCSBA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|