C15H22N2O4S2 — CID 55823578
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-propylsulfanylacetamide (PubChem CID 55823578) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-propylsulfanylacetamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-propylsulfanylacetamide |
|---|---|
| PubChem CID | 55823578 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-propylsulfanylacetamide |
| SMILES | CCCSCC(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C15H22N2O4S2/c1-2-9-22-11-15(19)16-13-10-12(5-6-14(13)18)23(20,21)17-7-3-4-8-17/h5-6,10,18H,2-4,7-9,11H2,1H3,(H,16,19) |
| InChIKey | CTHWTPHIAOQAHV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|