C15H18Cl2N2O4S — CID 43035130
2,2-dichloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 43035130) has the molecular formula C15H18Cl2N2O4S and a molecular weight of 393.29 g/mol. Its IUPAC name is 2,2-dichloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43035130 |
| Molecular Formula | C15H18Cl2N2O4S |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2,2-dichloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2cc(S(=O)(=O)N3CCCC3)ccc2O)CC1(Cl)Cl |
| InChI | InChI=1S/C15H18Cl2N2O4S/c1-14(9-15(14,16)17)13(21)18-11-8-10(4-5-12(11)20)24(22,23)19-6-2-3-7-19/h4-5,8,20H,2-3,6-7,9H2,1H3,(H,18,21) |
| InChIKey | FQEQISIZXAGPIU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|