C19H27Cl2N3O4S — CID 43004744
2,2-dichloro-N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 43004744) has the molecular formula C19H27Cl2N3O4S and a molecular weight of 464.42 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43004744 |
| Molecular Formula | C19H27Cl2N3O4S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2,2-dichloro-N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)C1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C19H27Cl2N3O4S/c1-4-23(5-2)16-7-6-14(29(26,27)24-8-10-28-11-9-24)12-15(16)22-17(25)18(3)13-19(18,20)21/h6-7,12H,4-5,8-11,13H2,1-3H3,(H,22,25) |
| InChIKey | LTZSEROEYSPRRT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|