C23H31N3O4S2 — CID 42965288
N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2-methylphenyl)sulfanylacetamide (PubChem CID 42965288) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2-methylphenyl)sulfanylacetamide.
| Compound Name | N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 42965288 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2-methylphenyl)sulfanylacetamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)CSc1ccccc1C |
| InChI | InChI=1S/C23H31N3O4S2/c1-4-25(5-2)21-11-10-19(32(28,29)26-12-14-30-15-13-26)16-20(21)24-23(27)17-31-22-9-7-6-8-18(22)3/h6-11,16H,4-5,12-15,17H2,1-3H3,(H,24,27) |
| InChIKey | VPIMRCVJMFEVAO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |