C25H35N3O5S — CID 30587513
N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2-propan-2-ylphenoxy)acetamide (PubChem CID 30587513) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 30587513 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2-propan-2-ylphenoxy)acetamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COc1ccccc1C(C)C |
| InChI | InChI=1S/C25H35N3O5S/c1-5-27(6-2)23-12-11-20(34(30,31)28-13-15-32-16-14-28)17-22(23)26-25(29)18-33-24-10-8-7-9-21(24)19(3)4/h7-12,17,19H,5-6,13-16,18H2,1-4H3,(H,26,29) |
| InChIKey | CREUGVGONXMMAX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |