C24H30N4O5S — CID 55597453
2-(2-cyanophenoxy)-N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]propanamide (PubChem CID 55597453) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]propanamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]propanamide |
|---|---|
| PubChem CID | 55597453 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]propanamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)C(C)Oc1ccccc1C#N |
| InChI | InChI=1S/C24H30N4O5S/c1-4-27(5-2)22-11-10-20(34(30,31)28-12-14-32-15-13-28)16-21(22)26-24(29)18(3)33-23-9-7-6-8-19(23)17-25/h6-11,16,18H,4-5,12-15H2,1-3H3,(H,26,29) |
| InChIKey | HQSKDMFBDTWDRQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |