C25H31N5O4S — CID 30345312
N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(1-phenylpyrazol-4-yl)acetamide (PubChem CID 30345312) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(1-phenylpyrazol-4-yl)acetamide.
| Compound Name | N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(1-phenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 30345312 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(1-phenylpyrazol-4-yl)acetamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H31N5O4S/c1-3-28(4-2)24-11-10-22(35(32,33)29-12-14-34-15-13-29)17-23(24)27-25(31)16-20-18-26-30(19-20)21-8-6-5-7-9-21/h5-11,17-19H,3-4,12-16H2,1-2H3,(H,27,31) |
| InChIKey | PSWHLNMTCOYSES-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |