C20H27N3O5S — CID 55382027
N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-methylfuran-3-carboxamide (PubChem CID 55382027) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 55382027 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[2-(diethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-methylfuran-3-carboxamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)c1ccoc1C |
| InChI | InChI=1S/C20H27N3O5S/c1-4-22(5-2)19-7-6-16(29(25,26)23-9-12-27-13-10-23)14-18(19)21-20(24)17-8-11-28-15(17)3/h6-8,11,14H,4-5,9-10,12-13H2,1-3H3,(H,21,24) |
| InChIKey | OHGCBHVDXUXKQZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |