C14H22ClN3O4S — CID 120872676
3-amino-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)butanamide;hydrochloride (PubChem CID 120872676) has the molecular formula C14H22ClN3O4S and a molecular weight of 363.87 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)butanamide;hydrochloride.
| Compound Name | 3-amino-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120872676 |
| Molecular Formula | C14H22ClN3O4S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-amino-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O.Cl |
| InChI | InChI=1S/C14H21N3O4S.ClH/c1-10(15)8-14(19)16-12-9-11(4-5-13(12)18)22(20,21)17-6-2-3-7-17;/h4-5,9-10,18H,2-3,6-8,15H2,1H3,(H,16,19);1H |
| InChIKey | NMNNDRXHLKZKLW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|