C21H25N3O7S2 — CID 27672653
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 27672653) has the molecular formula C21H25N3O7S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 27672653 |
| Molecular Formula | C21H25N3O7S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCCC2)ccc1O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25N3O7S2/c25-20-8-7-18(33(29,30)23-9-1-2-10-23)15-19(20)22-21(26)16-3-5-17(6-4-16)32(27,28)24-11-13-31-14-12-24/h3-8,15,25H,1-2,9-14H2,(H,22,26) |
| InChIKey | IOMOUFKXGMWOQS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|