C18H18F2N2O6S — CID 35979257
3-(difluoromethoxy)-N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 35979257) has the molecular formula C18H18F2N2O6S and a molecular weight of 428.41 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 3-(difluoromethoxy)-N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 35979257 |
| Molecular Formula | C18H18F2N2O6S |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 3-(difluoromethoxy)-N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C18H18F2N2O6S/c19-18(20)28-13-3-1-2-12(10-13)17(24)21-15-11-14(4-5-16(15)23)29(25,26)22-6-8-27-9-7-22/h1-5,10-11,18,23H,6-9H2,(H,21,24) |
| InChIKey | XKXGZZSTNWRLAF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|