C22H25F2N3O6S — CID 3979887
4-(difluoromethoxy)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 3979887) has the molecular formula C22H25F2N3O6S and a molecular weight of 497.52 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 3979887 |
| Molecular Formula | C22H25F2N3O6S |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 4-(difluoromethoxy)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H25F2N3O6S/c23-22(24)33-17-3-1-16(2-4-17)21(28)25-19-15-18(34(29,30)27-9-13-32-14-10-27)5-6-20(19)26-7-11-31-12-8-26/h1-6,15,22H,7-14H2,(H,25,28) |
| InChIKey | VPPSZXYOZPEUPC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |