C25H29N5O4S — CID 55369390
N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)-4-pyrazol-1-ylbenzamide (PubChem CID 55369390) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)-4-pyrazol-1-ylbenzamide.
| Compound Name | N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)-4-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 55369390 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)-4-pyrazol-1-ylbenzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCCC1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C25H29N5O4S/c31-25(20-5-7-21(8-6-20)30-14-4-11-26-30)27-23-19-22(35(32,33)29-15-17-34-18-16-29)9-10-24(23)28-12-2-1-3-13-28/h4-11,14,19H,1-3,12-13,15-18H2,(H,27,31) |
| InChIKey | FGDWIFLXBSGOFZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |