C22H25F2N3O4S — CID 55375411
2,5-difluoro-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)benzamide (PubChem CID 55375411) has the molecular formula C22H25F2N3O4S and a molecular weight of 465.52 g/mol. Its IUPAC name is 2,5-difluoro-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)benzamide.
| Compound Name | 2,5-difluoro-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 55375411 |
| Molecular Formula | C22H25F2N3O4S |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2,5-difluoro-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C22H25F2N3O4S/c23-16-4-6-19(24)18(14-16)22(28)25-20-15-17(32(29,30)27-10-12-31-13-11-27)5-7-21(20)26-8-2-1-3-9-26/h4-7,14-15H,1-3,8-13H2,(H,25,28) |
| InChIKey | IACMAYSWXVPGKN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |