C21H23F2N3O4S — CID 31509173
N-(2,5-difluorophenyl)-5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 31509173) has the molecular formula C21H23F2N3O4S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(2,5-difluorophenyl)-5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 31509173 |
| Molecular Formula | C21H23F2N3O4S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-(2,5-difluorophenyl)-5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H23F2N3O4S/c22-15-3-5-18(23)19(13-15)24-21(27)17-14-16(4-6-20(17)25-7-1-2-8-25)31(28,29)26-9-11-30-12-10-26/h3-6,13-14H,1-2,7-12H2,(H,24,27) |
| InChIKey | HTMMCVFEXRWJFJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |