C24H31N3O8S — CID 4857247
2,4,5-trimethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 4857247) has the molecular formula C24H31N3O8S and a molecular weight of 521.59 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 2,4,5-trimethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 4857247 |
| Molecular Formula | C24H31N3O8S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 2,4,5-trimethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2N2CCOCC2)cc1OC |
| InChI | InChI=1S/C24H31N3O8S/c1-31-21-16-23(33-3)22(32-2)15-18(21)24(28)25-19-14-17(36(29,30)27-8-12-35-13-9-27)4-5-20(19)26-6-10-34-11-7-26/h4-5,14-16H,6-13H2,1-3H3,(H,25,28) |
| InChIKey | RQLGGBAIWQJXAB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |