C19H20Cl2N2O6S — CID 26210560
2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 26210560) has the molecular formula C19H20Cl2N2O6S and a molecular weight of 475.35 g/mol. Its IUPAC name is 2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26210560 |
| Molecular Formula | C19H20Cl2N2O6S |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1cc(OC)c(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O6S/c1-27-17-11-18(28-2)16(10-15(17)21)22-19(24)13-9-12(3-4-14(13)20)30(25,26)23-5-7-29-8-6-23/h3-4,9-11H,5-8H2,1-2H3,(H,22,24) |
| InChIKey | LOBDRZHHIOLSOQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |