C17H15Cl3N2O4S — CID 26591526
2-chloro-N-(3,5-dichlorophenyl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 26591526) has the molecular formula C17H15Cl3N2O4S and a molecular weight of 449.74 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichlorophenyl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(3,5-dichlorophenyl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26591526 |
| Molecular Formula | C17H15Cl3N2O4S |
| Molecular Weight | 449.74 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | 2-chloro-N-(3,5-dichlorophenyl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C17H15Cl3N2O4S/c18-11-7-12(19)9-13(8-11)21-17(23)15-10-14(1-2-16(15)20)27(24,25)22-3-5-26-6-4-22/h1-2,7-10H,3-6H2,(H,21,23) |
| InChIKey | GQIATWUGUCNOKW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.74 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |