C21H20ClN5O6S2 — CID 99942897
2-chloro-5-morpholin-4-ylsulfonyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 99942897) has the molecular formula C21H20ClN5O6S2 and a molecular weight of 538.01 g/mol. Its IUPAC name is 2-chloro-5-morpholin-4-ylsulfonyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 99942897 |
| Molecular Formula | C21H20ClN5O6S2 |
| Molecular Weight | 538.01 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C21H20ClN5O6S2/c22-19-7-6-17(35(31,32)27-10-12-33-13-11-27)14-18(19)20(28)25-15-2-4-16(5-3-15)34(29,30)26-21-23-8-1-9-24-21/h1-9,14H,10-13H2,(H,25,28)(H,23,24,26) |
| InChIKey | ZNYWQZKDLDNRTJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.01 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |