C21H23Cl2N3O6S2 — CID 3344196
2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 3344196) has the molecular formula C21H23Cl2N3O6S2 and a molecular weight of 548.47 g/mol. Its IUPAC name is 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 3344196 |
| Molecular Formula | C21H23Cl2N3O6S2 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O6S2/c22-18-14-19(23)20(34(30,31)26-9-11-32-12-10-26)13-17(18)21(27)24-15-3-5-16(6-4-15)33(28,29)25-7-1-2-8-25/h3-6,13-14H,1-2,7-12H2,(H,24,27) |
| InChIKey | MEIMNXQCSKYCLC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |