C19H20Cl2N2O3S — CID 1010211
N-[4-(azepan-1-ylsulfonyl)phenyl]-2,4-dichlorobenzamide (PubChem CID 1010211) has the molecular formula C19H20Cl2N2O3S and a molecular weight of 427.35 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 1010211 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O3S/c20-14-5-10-17(18(21)13-14)19(24)22-15-6-8-16(9-7-15)27(25,26)23-11-3-1-2-4-12-23/h5-10,13H,1-4,11-12H2,(H,22,24) |
| InChIKey | GANZQIODGXGZBW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |