C19H22ClN3O5S2 — CID 92681738
2-chloro-4-(methanesulfonamido)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 92681738) has the molecular formula C19H22ClN3O5S2 and a molecular weight of 471.99 g/mol. Its IUPAC name is 2-chloro-4-(methanesulfonamido)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2-chloro-4-(methanesulfonamido)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 92681738 |
| Molecular Formula | C19H22ClN3O5S2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-chloro-4-(methanesulfonamido)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClN3O5S2/c1-29(25,26)22-15-7-10-17(18(20)13-15)19(24)21-14-5-8-16(9-6-14)30(27,28)23-11-3-2-4-12-23/h5-10,13,22H,2-4,11-12H2,1H3,(H,21,24) |
| InChIKey | FTTWWVBXSYGPKB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |