C32H38N4O6S2 — CID 5167539
1-N,4-N-bis[4-(azepan-1-ylsulfonyl)phenyl]benzene-1,4-dicarboxamide (PubChem CID 5167539) has the molecular formula C32H38N4O6S2 and a molecular weight of 638.81 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(azepan-1-ylsulfonyl)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-(azepan-1-ylsulfonyl)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 5167539 |
| Molecular Formula | C32H38N4O6S2 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | 1-N,4-N-bis[4-(azepan-1-ylsulfonyl)phenyl]benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C32H38N4O6S2/c37-31(33-27-13-17-29(18-14-27)43(39,40)35-21-5-1-2-6-22-35)25-9-11-26(12-10-25)32(38)34-28-15-19-30(20-16-28)44(41,42)36-23-7-3-4-8-24-36/h9-20H,1-8,21-24H2,(H,33,37)(H,34,38) |
| InChIKey | RYAADKRGGLKBQV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |