C22H30N4O5S2 — CID 92642400
N-[4-(azepan-1-ylsulfonyl)phenyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide (PubChem CID 92642400) has the molecular formula C22H30N4O5S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 92642400 |
| Molecular Formula | C22H30N4O5S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide |
| SMILES | CN(C)S(=O)(=O)N(C)c1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H30N4O5S2/c1-24(2)33(30,31)25(3)20-12-8-18(9-13-20)22(27)23-19-10-14-21(15-11-19)32(28,29)26-16-6-4-5-7-17-26/h8-15H,4-7,16-17H2,1-3H3,(H,23,27) |
| InChIKey | CEQCGJDLGQIZBO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |