C25H27N3O5S2 — CID 4849780
4-[methyl(phenyl)sulfamoyl]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 4849780) has the molecular formula C25H27N3O5S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is 4-[methyl(phenyl)sulfamoyl]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 4-[methyl(phenyl)sulfamoyl]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 4849780 |
| Molecular Formula | C25H27N3O5S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 4-[methyl(phenyl)sulfamoyl]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O5S2/c1-27(22-8-4-2-5-9-22)34(30,31)23-14-10-20(11-15-23)25(29)26-21-12-16-24(17-13-21)35(32,33)28-18-6-3-7-19-28/h2,4-5,8-17H,3,6-7,18-19H2,1H3,(H,26,29) |
| InChIKey | VJYMUKOSINYCQV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |