C18H21N3O3S — CID 9479606
N'-methyl-N'-phenyl-4-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 9479606) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-4-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-methyl-N'-phenyl-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 9479606 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N'-methyl-N'-phenyl-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | CN(NC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O3S/c1-20(16-7-3-2-4-8-16)19-18(22)15-9-11-17(12-10-15)25(23,24)21-13-5-6-14-21/h2-4,7-12H,5-6,13-14H2,1H3,(H,19,22) |
| InChIKey | STOAZTKGZWVWFD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|