C13H18N2O3S — CID 26264709
N-ethyl-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 26264709) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-ethyl-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-ethyl-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26264709 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-ethyl-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCNC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-2-14-13(16)11-5-7-12(8-6-11)19(17,18)15-9-3-4-10-15/h5-8H,2-4,9-10H2,1H3,(H,14,16) |
| InChIKey | IATSPRGMJQINJO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |