C16H22N2O5S — CID 8698092
methyl 4-[(4-pyrrolidin-1-ylsulfonylbenzoyl)amino]butanoate (PubChem CID 8698092) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is methyl 4-[(4-pyrrolidin-1-ylsulfonylbenzoyl)amino]butanoate.
| Compound Name | methyl 4-[(4-pyrrolidin-1-ylsulfonylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 8698092 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | methyl 4-[(4-pyrrolidin-1-ylsulfonylbenzoyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H22N2O5S/c1-23-15(19)5-4-10-17-16(20)13-6-8-14(9-7-13)24(21,22)18-11-2-3-12-18/h6-9H,2-5,10-12H2,1H3,(H,17,20) |
| InChIKey | QKXNEYWBCQFDKP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|