C18H24N2O7S — CID 9334670
[2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 9334670) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is [2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 9334670 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COC(=O)CCCNC(=O)COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O7S/c1-26-17(22)5-4-10-19-16(21)13-27-18(23)14-6-8-15(9-7-14)28(24,25)20-11-2-3-12-20/h6-9H,2-5,10-13H2,1H3,(H,19,21) |
| InChIKey | LONKYKUXCANNRA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|