C20H21N3O6S — CID 29169317
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 29169317) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 29169317 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O6S/c24-18(21-22-19(25)15-6-2-1-3-7-15)14-29-20(26)16-8-10-17(11-9-16)30(27,28)23-12-4-5-13-23/h1-3,6-11H,4-5,12-14H2,(H,21,24)(H,22,25) |
| InChIKey | AOCLZPIKVTWCTI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|